C10H12F2O2 — CID 105411055
2-[(3,5-difluorophenyl)methyl]propane-1,3-diol (PubChem CID 105411055) has the molecular formula C10H12F2O2 and a molecular weight of 202.20 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methyl]propane-1,3-diol.
| Compound Name | 2-[(3,5-difluorophenyl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 105411055 |
| Molecular Formula | C10H12F2O2 |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methyl]propane-1,3-diol |
| SMILES | OCC(CO)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H12F2O2/c11-9-2-7(3-10(12)4-9)1-8(5-13)6-14/h2-4,8,13-14H,1,5-6H2 |
| InChIKey | UBWDEKURVWDGEM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |