C9H11F2NO — CID 162341885
(2R)-2-amino-3-(3,5-difluorophenyl)propan-1-ol (PubChem CID 162341885) has the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. Its IUPAC name is (2R)-2-amino-3-(3,5-difluorophenyl)propan-1-ol.
| Compound Name | (2R)-2-amino-3-(3,5-difluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 162341885 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (2R)-2-amino-3-(3,5-difluorophenyl)propan-1-ol |
| SMILES | N[C@@H](CO)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C9H11F2NO/c10-7-1-6(2-8(11)4-7)3-9(12)5-13/h1-2,4,9,13H,3,5,12H2/t9-/m1/s1 |
| InChIKey | ZFNQOFXFLOCCTI-SECBINFHSA-N |
| XLogP | 0.83 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |