C10H12ClF2N — CID 89258105
(2S)-4-chloro-1-(3,5-difluorophenyl)butan-2-amine (PubChem CID 89258105) has the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. Its IUPAC name is (2S)-4-chloro-1-(3,5-difluorophenyl)butan-2-amine.
| Compound Name | (2S)-4-chloro-1-(3,5-difluorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 89258105 |
| Molecular Formula | C10H12ClF2N |
| Molecular Weight | 219.66 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | (2S)-4-chloro-1-(3,5-difluorophenyl)butan-2-amine |
| SMILES | N[C@H](CCCl)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H12ClF2N/c11-2-1-10(14)5-7-3-8(12)6-9(13)4-7/h3-4,6,10H,1-2,5,14H2/t10-/m1/s1 |
| InChIKey | JNPKSLOVKCNCJX-SNVBAGLBSA-N |
| XLogP | 2.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.66 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|