C12H17F2NS — CID 105406246
1-(3,5-difluorophenyl)-3-propylsulfanylpropan-2-amine (PubChem CID 105406246) has the molecular formula C12H17F2NS and a molecular weight of 245.34 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-propylsulfanylpropan-2-amine.
| Compound Name | 1-(3,5-difluorophenyl)-3-propylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 105406246 |
| Molecular Formula | C12H17F2NS |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-propylsulfanylpropan-2-amine |
| SMILES | CCCSCC(N)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H17F2NS/c1-2-3-16-8-12(15)6-9-4-10(13)7-11(14)5-9/h4-5,7,12H,2-3,6,8,15H2,1H3 |
| InChIKey | ISAGBNACRBFKGR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|