C14H21F2NS — CID 105406250
1-(3,5-difluorophenyl)-N-ethyl-3-propylsulfanylpropan-2-amine (PubChem CID 105406250) has the molecular formula C14H21F2NS and a molecular weight of 273.39 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-N-ethyl-3-propylsulfanylpropan-2-amine.
| Compound Name | 1-(3,5-difluorophenyl)-N-ethyl-3-propylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 105406250 |
| Molecular Formula | C14H21F2NS |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 1-(3,5-difluorophenyl)-N-ethyl-3-propylsulfanylpropan-2-amine |
| SMILES | CCCSCC(Cc1cc(F)cc(F)c1)NCC |
| InChI | InChI=1S/C14H21F2NS/c1-3-5-18-10-14(17-4-2)8-11-6-12(15)9-13(16)7-11/h6-7,9,14,17H,3-5,8,10H2,1-2H3 |
| InChIKey | GGUZIOGOUXEIKT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|