C15H24FNS — CID 65135077
N-ethyl-1-(3-fluorophenyl)-3-(2-methylpropylsulfanyl)propan-2-amine (PubChem CID 65135077) has the molecular formula C15H24FNS and a molecular weight of 269.43 g/mol. Its IUPAC name is N-ethyl-1-(3-fluorophenyl)-3-(2-methylpropylsulfanyl)propan-2-amine.
| Compound Name | N-ethyl-1-(3-fluorophenyl)-3-(2-methylpropylsulfanyl)propan-2-amine |
|---|---|
| PubChem CID | 65135077 |
| Molecular Formula | C15H24FNS |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-ethyl-1-(3-fluorophenyl)-3-(2-methylpropylsulfanyl)propan-2-amine |
| SMILES | CCNC(CSCC(C)C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H24FNS/c1-4-17-15(11-18-10-12(2)3)9-13-6-5-7-14(16)8-13/h5-8,12,15,17H,4,9-11H2,1-3H3 |
| InChIKey | OSBILKAAXXSFPO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |