C15H23ClFNS — CID 112653767
1-(2-chloro-3-fluorophenyl)-N-ethyl-3-(2-methylpropylsulfanyl)propan-2-amine (PubChem CID 112653767) has the molecular formula C15H23ClFNS and a molecular weight of 303.87 g/mol. Its IUPAC name is 1-(2-chloro-3-fluorophenyl)-N-ethyl-3-(2-methylpropylsulfanyl)propan-2-amine.
| Compound Name | 1-(2-chloro-3-fluorophenyl)-N-ethyl-3-(2-methylpropylsulfanyl)propan-2-amine |
|---|---|
| PubChem CID | 112653767 |
| Molecular Formula | C15H23ClFNS |
| Molecular Weight | 303.87 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-(2-chloro-3-fluorophenyl)-N-ethyl-3-(2-methylpropylsulfanyl)propan-2-amine |
| SMILES | CCNC(CSCC(C)C)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C15H23ClFNS/c1-4-18-13(10-19-9-11(2)3)8-12-6-5-7-14(17)15(12)16/h5-7,11,13,18H,4,8-10H2,1-3H3 |
| InChIKey | GEBDNWQOVJBUMJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.87 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |