C16H15Cl2F2N — CID 105032410
1,2-bis(2-chloro-3-fluorophenyl)-N-ethylethanamine (PubChem CID 105032410) has the molecular formula C16H15Cl2F2N and a molecular weight of 330.21 g/mol. Its IUPAC name is 1,2-bis(2-chloro-3-fluorophenyl)-N-ethylethanamine.
| Compound Name | 1,2-bis(2-chloro-3-fluorophenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 105032410 |
| Molecular Formula | C16H15Cl2F2N |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 1,2-bis(2-chloro-3-fluorophenyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1cccc(F)c1Cl)c1cccc(F)c1Cl |
| InChI | InChI=1S/C16H15Cl2F2N/c1-2-21-14(11-6-4-8-13(20)16(11)18)9-10-5-3-7-12(19)15(10)17/h3-8,14,21H,2,9H2,1H3 |
| InChIKey | IVKVKRSTSOLUCF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |