C16H18ClFN2 — CID 114878334
2-(2-chloro-3-fluorophenyl)-N-ethyl-1-(4-methyl-3-pyridinyl)ethanamine (PubChem CID 114878334) has the molecular formula C16H18ClFN2 and a molecular weight of 292.79 g/mol. Its IUPAC name is 2-(2-chloro-3-fluorophenyl)-N-ethyl-1-(4-methyl-3-pyridinyl)ethanamine.
| Compound Name | 2-(2-chloro-3-fluorophenyl)-N-ethyl-1-(4-methyl-3-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 114878334 |
| Molecular Formula | C16H18ClFN2 |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-(2-chloro-3-fluorophenyl)-N-ethyl-1-(4-methyl-3-pyridinyl)ethanamine |
| SMILES | CCNC(Cc1cccc(F)c1Cl)c1cnccc1C |
| InChI | InChI=1S/C16H18ClFN2/c1-3-20-15(13-10-19-8-7-11(13)2)9-12-5-4-6-14(18)16(12)17/h4-8,10,15,20H,3,9H2,1-2H3 |
| InChIKey | FKLSPLQKXMJFPE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |