C13H22N2S — CID 104736344
N-ethyl-1-propylsulfanyl-3-pyridin-3-ylpropan-2-amine (PubChem CID 104736344) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is N-ethyl-1-propylsulfanyl-3-pyridin-3-ylpropan-2-amine.
| Compound Name | N-ethyl-1-propylsulfanyl-3-pyridin-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 104736344 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-ethyl-1-propylsulfanyl-3-pyridin-3-ylpropan-2-amine |
| SMILES | CCCSCC(Cc1cccnc1)NCC |
| InChI | InChI=1S/C13H22N2S/c1-3-8-16-11-13(15-4-2)9-12-6-5-7-14-10-12/h5-7,10,13,15H,3-4,8-9,11H2,1-2H3 |
| InChIKey | SQSCANUIVKRGKE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|