C14H21Cl2NS — CID 65128864
1-(2,6-dichlorophenyl)-N-ethyl-3-propylsulfanylpropan-2-amine (PubChem CID 65128864) has the molecular formula C14H21Cl2NS and a molecular weight of 306.30 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-ethyl-3-propylsulfanylpropan-2-amine.
| Compound Name | 1-(2,6-dichlorophenyl)-N-ethyl-3-propylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 65128864 |
| Molecular Formula | C14H21Cl2NS |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-ethyl-3-propylsulfanylpropan-2-amine |
| SMILES | CCCSCC(Cc1c(Cl)cccc1Cl)NCC |
| InChI | InChI=1S/C14H21Cl2NS/c1-3-8-18-10-11(17-4-2)9-12-13(15)6-5-7-14(12)16/h5-7,11,17H,3-4,8-10H2,1-2H3 |
| InChIKey | WULSWSQTZLQJKO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|