C13H24ClN3S — CID 113470284
1-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-ethyl-3-propylsulfanylpropan-2-amine (PubChem CID 113470284) has the molecular formula C13H24ClN3S and a molecular weight of 289.88 g/mol. Its IUPAC name is 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-ethyl-3-propylsulfanylpropan-2-amine.
| Compound Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-ethyl-3-propylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 113470284 |
| Molecular Formula | C13H24ClN3S |
| Molecular Weight | 289.88 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-ethyl-3-propylsulfanylpropan-2-amine |
| SMILES | CCCSCC(Cc1c(C)nn(C)c1Cl)NCC |
| InChI | InChI=1S/C13H24ClN3S/c1-5-7-18-9-11(15-6-2)8-12-10(3)16-17(4)13(12)14/h11,15H,5-9H2,1-4H3 |
| InChIKey | FAFXWXNPUBZQAC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.88 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|