C11H18ClN3 — CID 116660558
1-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-methylpent-4-en-2-amine (PubChem CID 116660558) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-methylpent-4-en-2-amine.
| Compound Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-methylpent-4-en-2-amine |
|---|---|
| PubChem CID | 116660558 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-methylpent-4-en-2-amine |
| SMILES | C=CCC(Cc1c(C)nn(C)c1Cl)NC |
| InChI | InChI=1S/C11H18ClN3/c1-5-6-9(13-3)7-10-8(2)14-15(4)11(10)12/h5,9,13H,1,6-7H2,2-4H3 |
| InChIKey | HKHPSKBAPNYLTF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|