C9H14ClN3 — CID 115576248
N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]prop-2-en-1-amine (PubChem CID 115576248) has the molecular formula C9H14ClN3 and a molecular weight of 199.68 g/mol. Its IUPAC name is N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]prop-2-en-1-amine.
| Compound Name | N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 115576248 |
| Molecular Formula | C9H14ClN3 |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C9H14ClN3/c1-4-5-11-6-8-7(2)12-13(3)9(8)10/h4,11H,1,5-6H2,2-3H3 |
| InChIKey | SQPZASGKELCUJI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|