C12H21Cl2N3 — CID 107155986
2-chloro-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-methylpentan-1-amine (PubChem CID 107155986) has the molecular formula C12H21Cl2N3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 2-chloro-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-methylpentan-1-amine.
| Compound Name | 2-chloro-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 107155986 |
| Molecular Formula | C12H21Cl2N3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-chloro-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-methylpentan-1-amine |
| SMILES | Cc1nn(C)c(Cl)c1CNCC(Cl)CC(C)C |
| InChI | InChI=1S/C12H21Cl2N3/c1-8(2)5-10(13)6-15-7-11-9(3)16-17(4)12(11)14/h8,10,15H,5-7H2,1-4H3 |
| InChIKey | ORPMPNGBOWEHRH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|