C10H17Cl2N3 — CID 106844376
4-chloro-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine (PubChem CID 106844376) has the molecular formula C10H17Cl2N3 and a molecular weight of 250.17 g/mol. Its IUPAC name is 4-chloro-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine.
| Compound Name | 4-chloro-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 106844376 |
| Molecular Formula | C10H17Cl2N3 |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 4-chloro-N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]butan-1-amine |
| SMILES | Cc1nn(C)c(Cl)c1CNCCCCCl |
| InChI | InChI=1S/C10H17Cl2N3/c1-8-9(10(12)15(2)14-8)7-13-6-4-3-5-11/h13H,3-7H2,1-2H3 |
| InChIKey | NRNJLHBJLHKUFB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|