C12H19ClN4O — CID 115595850
3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]-N-cyclopropylpropanamide (PubChem CID 115595850) has the molecular formula C12H19ClN4O and a molecular weight of 270.76 g/mol. Its IUPAC name is 3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]-N-cyclopropylpropanamide.
| Compound Name | 3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 115595850 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]-N-cyclopropylpropanamide |
| SMILES | Cc1nn(C)c(Cl)c1CNCCC(=O)NC1CC1 |
| InChI | InChI=1S/C12H19ClN4O/c1-8-10(12(13)17(2)16-8)7-14-6-5-11(18)15-9-3-4-9/h9,14H,3-7H2,1-2H3,(H,15,18) |
| InChIKey | VKGJYKZZGGDFHG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|