C13H23ClN4O — CID 115584824
3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]-N,N-diethylpropanamide (PubChem CID 115584824) has the molecular formula C13H23ClN4O and a molecular weight of 286.81 g/mol. Its IUPAC name is 3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]-N,N-diethylpropanamide.
| Compound Name | 3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 115584824 |
| Molecular Formula | C13H23ClN4O |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNCc1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C13H23ClN4O/c1-5-18(6-2)12(19)7-8-15-9-11-10(3)16-17(4)13(11)14/h15H,5-9H2,1-4H3 |
| InChIKey | RAFLUPQKWZQMNK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|