C11H16ClN3S — CID 115642869
N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-prop-2-ynylsulfanylethanamine (PubChem CID 115642869) has the molecular formula C11H16ClN3S and a molecular weight of 257.79 g/mol. Its IUPAC name is N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-prop-2-ynylsulfanylethanamine.
| Compound Name | N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-prop-2-ynylsulfanylethanamine |
|---|---|
| PubChem CID | 115642869 |
| Molecular Formula | C11H16ClN3S |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2-prop-2-ynylsulfanylethanamine |
| SMILES | C#CCSCCNCc1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C11H16ClN3S/c1-4-6-16-7-5-13-8-10-9(2)14-15(3)11(10)12/h1,13H,5-8H2,2-3H3 |
| InChIKey | UZVBTJSJKQVKGU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|