C12H22ClN3O2 — CID 114032974
1-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-(2-methoxyethoxy)-N-methylpropan-2-amine (PubChem CID 114032974) has the molecular formula C12H22ClN3O2 and a molecular weight of 275.78 g/mol. Its IUPAC name is 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-(2-methoxyethoxy)-N-methylpropan-2-amine.
| Compound Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-(2-methoxyethoxy)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 114032974 |
| Molecular Formula | C12H22ClN3O2 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-(2-methoxyethoxy)-N-methylpropan-2-amine |
| SMILES | CNC(COCCOC)Cc1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C12H22ClN3O2/c1-9-11(12(13)16(3)15-9)7-10(14-2)8-18-6-5-17-4/h10,14H,5-8H2,1-4H3 |
| InChIKey | DWXBOYGVRREKAY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|