C10H23NO4 — CID 176738271
1,3-bis(2-methoxyethoxy)-N-methylpropan-2-amine (PubChem CID 176738271) has the molecular formula C10H23NO4 and a molecular weight of 221.30 g/mol. Its IUPAC name is 1,3-bis(2-methoxyethoxy)-N-methylpropan-2-amine.
| Compound Name | 1,3-bis(2-methoxyethoxy)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 176738271 |
| Molecular Formula | C10H23NO4 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1,3-bis(2-methoxyethoxy)-N-methylpropan-2-amine |
| SMILES | CNC(COCCOC)COCCOC |
| InChI | InChI=1S/C10H23NO4/c1-11-10(8-14-6-4-12-2)9-15-7-5-13-3/h10-11H,4-9H2,1-3H3 |
| InChIKey | CDQIOJFEFOAJTK-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|