C12H27NO3 — CID 104560721
1-[2-(2-methoxyethoxy)ethoxy]-N,3-dimethylpentan-2-amine (PubChem CID 104560721) has the molecular formula C12H27NO3 and a molecular weight of 233.35 g/mol. Its IUPAC name is 1-[2-(2-methoxyethoxy)ethoxy]-N,3-dimethylpentan-2-amine.
| Compound Name | 1-[2-(2-methoxyethoxy)ethoxy]-N,3-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 104560721 |
| Molecular Formula | C12H27NO3 |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | 1-[2-(2-methoxyethoxy)ethoxy]-N,3-dimethylpentan-2-amine |
| SMILES | CCC(C)C(COCCOCCOC)NC |
| InChI | InChI=1S/C12H27NO3/c1-5-11(2)12(13-3)10-16-9-8-15-7-6-14-4/h11-13H,5-10H2,1-4H3 |
| InChIKey | HOSIIAURNZMSOC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|