C11H21ClN4 — CID 105245830
1-(5-chloro-1,3-dimethylpyrazol-4-yl)hexan-2-ylhydrazine (PubChem CID 105245830) has the molecular formula C11H21ClN4 and a molecular weight of 244.77 g/mol. Its IUPAC name is 1-(5-chloro-1,3-dimethylpyrazol-4-yl)hexan-2-ylhydrazine.
| Compound Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)hexan-2-ylhydrazine |
|---|---|
| PubChem CID | 105245830 |
| Molecular Formula | C11H21ClN4 |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)hexan-2-ylhydrazine |
| SMILES | CCCCC(Cc1c(C)nn(C)c1Cl)NN |
| InChI | InChI=1S/C11H21ClN4/c1-4-5-6-9(14-13)7-10-8(2)15-16(3)11(10)12/h9,14H,4-7,13H2,1-3H3 |
| InChIKey | SSBXNNOEJUWKMN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|