C15H23BrFNS — CID 79709297
1-(3-bromo-5-fluorophenyl)-3-tert-butylsulfanyl-N-ethylpropan-2-amine (PubChem CID 79709297) has the molecular formula C15H23BrFNS and a molecular weight of 348.33 g/mol. Its IUPAC name is 1-(3-bromo-5-fluorophenyl)-3-tert-butylsulfanyl-N-ethylpropan-2-amine.
| Compound Name | 1-(3-bromo-5-fluorophenyl)-3-tert-butylsulfanyl-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 79709297 |
| Molecular Formula | C15H23BrFNS |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 1-(3-bromo-5-fluorophenyl)-3-tert-butylsulfanyl-N-ethylpropan-2-amine |
| SMILES | CCNC(CSC(C)(C)C)Cc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C15H23BrFNS/c1-5-18-14(10-19-15(2,3)4)8-11-6-12(16)9-13(17)7-11/h6-7,9,14,18H,5,8,10H2,1-4H3 |
| InChIKey | ZINHZFMSVOXRAA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |