C14H21BrFNO — CID 79708988
1-(3-bromo-5-fluorophenyl)-N-ethyl-3-methoxy-3-methylbutan-2-amine (PubChem CID 79708988) has the molecular formula C14H21BrFNO and a molecular weight of 318.23 g/mol. Its IUPAC name is 1-(3-bromo-5-fluorophenyl)-N-ethyl-3-methoxy-3-methylbutan-2-amine.
| Compound Name | 1-(3-bromo-5-fluorophenyl)-N-ethyl-3-methoxy-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 79708988 |
| Molecular Formula | C14H21BrFNO |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-(3-bromo-5-fluorophenyl)-N-ethyl-3-methoxy-3-methylbutan-2-amine |
| SMILES | CCNC(Cc1cc(F)cc(Br)c1)C(C)(C)OC |
| InChI | InChI=1S/C14H21BrFNO/c1-5-17-13(14(2,3)18-4)8-10-6-11(15)9-12(16)7-10/h6-7,9,13,17H,5,8H2,1-4H3 |
| InChIKey | WRQVMKRAYXCNQG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |