C9H9ClF2 — CID 126973917
1-(2-chloropropyl)-3,5-difluorobenzene (PubChem CID 126973917) has the molecular formula C9H9ClF2 and a molecular weight of 190.62 g/mol. Its IUPAC name is 1-(2-chloropropyl)-3,5-difluorobenzene.
| Compound Name | 1-(2-chloropropyl)-3,5-difluorobenzene |
|---|---|
| PubChem CID | 126973917 |
| Molecular Formula | C9H9ClF2 |
| Molecular Weight | 190.62 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 1-(2-chloropropyl)-3,5-difluorobenzene |
| SMILES | CC(Cl)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C9H9ClF2/c1-6(10)2-7-3-8(11)5-9(12)4-7/h3-6H,2H2,1H3 |
| InChIKey | DEGFQMZWZWIFEA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.62 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|