C10H11F2NO2 — CID 58759908
methyl (2S)-3-(3,5-difluorophenyl)-2-(tritioamino)propanoate (PubChem CID 58759908) has the molecular formula C10H11F2NO2 and a molecular weight of 217.21 g/mol. Its IUPAC name is methyl (2S)-3-(3,5-difluorophenyl)-2-(tritioamino)propanoate.
| Compound Name | methyl (2S)-3-(3,5-difluorophenyl)-2-(tritioamino)propanoate |
|---|---|
| PubChem CID | 58759908 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | methyl (2S)-3-(3,5-difluorophenyl)-2-(tritioamino)propanoate |
| SMILES | [3H]N[C@@H](Cc1cc(F)cc(F)c1)C(=O)OC |
| InChI | InChI=1S/C10H11F2NO2/c1-15-10(14)9(13)4-6-2-7(11)5-8(12)3-6/h2-3,5,9H,4,13H2,1H3/t9-/m0/s1/i/hT |
| InChIKey | NSKNSUFLKKGHKU-XXVSSCRASA-N |
| XLogP | 1.01 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |