About methyl (2R)-2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate
methyl (2R)-2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate (PubChem CID 171238105) has the molecular formula C10H11F2NO3
and a molecular weight of 231.20 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate.
Analyze methyl (2R)-2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate?
The IUPAC name of methyl (2R)-2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate (CID 171238105) is methyl (2R)-2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate.
What is the SMILES notation for methyl (2R)-2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate?
The canonical SMILES for methyl (2R)-2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate is COC(=O)[C@H](N)Cc1cc(F)cc(F)c1O.
What is the InChIKey of methyl (2R)-2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate?
The InChIKey is DXWDDTDVIZZNFC-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H11F2NO3/c1-16-10(15)8(13)3-5-2-6(11)4-7(12)9(5)14/h2,4,8,14H,3,13H2,1H3/t8-/m1/s1.
What are the key properties of methyl (2R)-2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate?
methyl (2R)-2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate has a molecular weight of 231.20 g/mol, XLogP of 0.71, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate is sourced from PubChem (CID 171238105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).