C11H13F2NO3 — CID 170885000
ethyl 2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate (PubChem CID 170885000) has the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. Its IUPAC name is ethyl 2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate.
| Compound Name | ethyl 2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 170885000 |
| Molecular Formula | C11H13F2NO3 |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | ethyl 2-amino-3-(3,5-difluoro-2-hydroxyphenyl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1cc(F)cc(F)c1O |
| InChI | InChI=1S/C11H13F2NO3/c1-2-17-11(16)9(14)4-6-3-7(12)5-8(13)10(6)15/h3,5,9,15H,2,4,14H2,1H3 |
| InChIKey | LAHFXABJGDRQAK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |