C11H14BrNO3 — CID 170884939
ethyl 2-amino-3-(2-bromo-5-hydroxyphenyl)propanoate (PubChem CID 170884939) has the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. Its IUPAC name is ethyl 2-amino-3-(2-bromo-5-hydroxyphenyl)propanoate.
| Compound Name | ethyl 2-amino-3-(2-bromo-5-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 170884939 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | ethyl 2-amino-3-(2-bromo-5-hydroxyphenyl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1cc(O)ccc1Br |
| InChI | InChI=1S/C11H14BrNO3/c1-2-16-11(15)10(13)6-7-5-8(14)3-4-9(7)12/h3-5,10,14H,2,6,13H2,1H3 |
| InChIKey | PCXBYBBKOKAWRC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |