C13H19NO4 — CID 141446103
ethyl 2-amino-3-[4-hydroxy-2-(1-hydroxyethyl)phenyl]propanoate (PubChem CID 141446103) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is ethyl 2-amino-3-[4-hydroxy-2-(1-hydroxyethyl)phenyl]propanoate.
| Compound Name | ethyl 2-amino-3-[4-hydroxy-2-(1-hydroxyethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 141446103 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | ethyl 2-amino-3-[4-hydroxy-2-(1-hydroxyethyl)phenyl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(O)cc1C(C)O |
| InChI | InChI=1S/C13H19NO4/c1-3-18-13(17)12(14)6-9-4-5-10(16)7-11(9)8(2)15/h4-5,7-8,12,15-16H,3,6,14H2,1-2H3 |
| InChIKey | ACEMAZTUWDCKSU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |