C11H13BrO5 — CID 171867406
ethyl 3-(2-bromo-5-hydroxyphenyl)-2,3-dihydroxypropanoate (PubChem CID 171867406) has the molecular formula C11H13BrO5 and a molecular weight of 305.12 g/mol. Its IUPAC name is ethyl 3-(2-bromo-5-hydroxyphenyl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(2-bromo-5-hydroxyphenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171867406 |
| Molecular Formula | C11H13BrO5 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | ethyl 3-(2-bromo-5-hydroxyphenyl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1cc(O)ccc1Br |
| InChI | InChI=1S/C11H13BrO5/c1-2-17-11(16)10(15)9(14)7-5-6(13)3-4-8(7)12/h3-5,9-10,13-15H,2H2,1H3 |
| InChIKey | HNQDVSCUZIDUEE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |