C12H13BrO6 — CID 171867408
ethyl 3-(6-bromo-1,3-benzodioxol-5-yl)-2,3-dihydroxypropanoate (PubChem CID 171867408) has the molecular formula C12H13BrO6 and a molecular weight of 333.13 g/mol. Its IUPAC name is ethyl 3-(6-bromo-1,3-benzodioxol-5-yl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(6-bromo-1,3-benzodioxol-5-yl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171867408 |
| Molecular Formula | C12H13BrO6 |
| Molecular Weight | 333.13 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | ethyl 3-(6-bromo-1,3-benzodioxol-5-yl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C12H13BrO6/c1-2-17-12(16)11(15)10(14)6-3-8-9(4-7(6)13)19-5-18-8/h3-4,10-11,14-15H,2,5H2,1H3 |
| InChIKey | LHDYRUFWMFEVRC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.13 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |