C12H16ClNO4 — CID 112694609
ethyl 2-amino-3-(5-chloro-2-hydroxy-3-methoxyphenyl)propanoate (PubChem CID 112694609) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is ethyl 2-amino-3-(5-chloro-2-hydroxy-3-methoxyphenyl)propanoate.
| Compound Name | ethyl 2-amino-3-(5-chloro-2-hydroxy-3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 112694609 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | ethyl 2-amino-3-(5-chloro-2-hydroxy-3-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1cc(Cl)cc(OC)c1O |
| InChI | InChI=1S/C12H16ClNO4/c1-3-18-12(16)9(14)5-7-4-8(13)6-10(17-2)11(7)15/h4,6,9,15H,3,5,14H2,1-2H3 |
| InChIKey | YUGRFTAXZMLAHN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |