C12H25NO3 — CID 160908077
N-methoxy-N,2-dimethylbutanamide;2-methylbutanal (PubChem CID 160908077) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is N-methoxy-N,2-dimethylbutanamide;2-methylbutanal.
| Compound Name | N-methoxy-N,2-dimethylbutanamide;2-methylbutanal |
|---|---|
| PubChem CID | 160908077 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | N-methoxy-N,2-dimethylbutanamide;2-methylbutanal |
| SMILES | CCC(C)C(=O)N(C)OC.CCC(C)C=O |
| InChI | InChI=1S/C7H15NO2.C5H10O/c1-5-6(2)7(9)8(3)10-4;1-3-5(2)4-6/h6H,5H2,1-4H3;4-5H,3H2,1-2H3 |
| InChIKey | SQKDYGPDJAPGEG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|