C14H33NO2 — CID 177191863
N-acetyl-N,2-dimethylbutanamide;ethane (PubChem CID 177191863) has the molecular formula C14H33NO2 and a molecular weight of 247.42 g/mol. Its IUPAC name is N-acetyl-N,2-dimethylbutanamide;ethane.
| Compound Name | N-acetyl-N,2-dimethylbutanamide;ethane |
|---|---|
| PubChem CID | 177191863 |
| Molecular Formula | C14H33NO2 |
| Molecular Weight | 247.42 g/mol |
| Exact Mass | 247.25 |
| IUPAC Name | N-acetyl-N,2-dimethylbutanamide;ethane |
| SMILES | CC.CC.CC.CCC(C)C(=O)N(C)C(C)=O |
| InChI | InChI=1S/C8H15NO2.3C2H6/c1-5-6(2)8(11)9(4)7(3)10;3*1-2/h6H,5H2,1-4H3;3*1-2H3 |
| InChIKey | IQCJOHORFIFHPF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |