C8H17NO — CID 89343843
N-ethyl-N,2-dimethylbutanamide (PubChem CID 89343843) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is N-ethyl-N,2-dimethylbutanamide.
| Compound Name | N-ethyl-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 89343843 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | N-ethyl-N,2-dimethylbutanamide |
| SMILES | CCC(C)C(=O)N(C)CC |
| InChI | InChI=1S/C8H17NO/c1-5-7(3)8(10)9(4)6-2/h7H,5-6H2,1-4H3 |
| InChIKey | GVPGICNRJDVIEC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |