About N-ethyl-N,2-dimethyl-3-oxobutanamide
N-ethyl-N,2-dimethyl-3-oxobutanamide (PubChem CID 18683063) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is N-ethyl-N,2-dimethyl-3-oxobutanamide.
Molecular Properties
| Compound Name | N-ethyl-N,2-dimethyl-3-oxobutanamide |
| PubChem CID | 18683063 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | N-ethyl-N,2-dimethyl-3-oxobutanamide |
| SMILES | CCN(C)C(=O)C(C)C(C)=O |
| InChI | InChI=1S/C8H15NO2/c1-5-9(4)8(11)6(2)7(3)10/h6H,5H2,1-4H3 |
| InChIKey | GLAZLMWEIZNTQC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N,2-dimethyl-3-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N,2-dimethyl-3-oxobutanamide?
The IUPAC name of N-ethyl-N,2-dimethyl-3-oxobutanamide (CID 18683063) is N-ethyl-N,2-dimethyl-3-oxobutanamide.
What is the SMILES notation for N-ethyl-N,2-dimethyl-3-oxobutanamide?
The canonical SMILES for N-ethyl-N,2-dimethyl-3-oxobutanamide is CCN(C)C(=O)C(C)C(C)=O.
What is the InChIKey of N-ethyl-N,2-dimethyl-3-oxobutanamide?
The InChIKey is GLAZLMWEIZNTQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-5-9(4)8(11)6(2)7(3)10/h6H,5H2,1-4H3.
What are the key properties of N-ethyl-N,2-dimethyl-3-oxobutanamide?
N-ethyl-N,2-dimethyl-3-oxobutanamide has a molecular weight of 157.21 g/mol, XLogP of 0.69, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N,2-dimethyl-3-oxobutanamide is sourced from PubChem (CID 18683063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).