C10H22N2O — CID 89069924
(2S,3S)-N-ethyl-N,3-dimethyl-2-(methylamino)pentanamide (PubChem CID 89069924) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is (2S,3S)-N-ethyl-N,3-dimethyl-2-(methylamino)pentanamide.
| Compound Name | (2S,3S)-N-ethyl-N,3-dimethyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 89069924 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | (2S,3S)-N-ethyl-N,3-dimethyl-2-(methylamino)pentanamide |
| SMILES | CC[C@H](C)[C@H](NC)C(=O)N(C)CC |
| InChI | InChI=1S/C10H22N2O/c1-6-8(3)9(11-4)10(13)12(5)7-2/h8-9,11H,6-7H2,1-5H3/t8-,9-/m0/s1 |
| InChIKey | KDVMQNQHUXUQMH-IUCAKERBSA-N |
| XLogP | 1.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |