C11H22N2O2 — CID 158124322
(2S,5S)-2,6-dimethyl-5-(methylamino)-4-oxooctanamide (PubChem CID 158124322) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (2S,5S)-2,6-dimethyl-5-(methylamino)-4-oxooctanamide.
| Compound Name | (2S,5S)-2,6-dimethyl-5-(methylamino)-4-oxooctanamide |
|---|---|
| PubChem CID | 158124322 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (2S,5S)-2,6-dimethyl-5-(methylamino)-4-oxooctanamide |
| SMILES | CCC(C)[C@H](NC)C(=O)C[C@H](C)C(N)=O |
| InChI | InChI=1S/C11H22N2O2/c1-5-7(2)10(13-4)9(14)6-8(3)11(12)15/h7-8,10,13H,5-6H2,1-4H3,(H2,12,15)/t7?,8-,10-/m0/s1 |
| InChIKey | GGZCKPZDUPAZSS-CFGJQEBVSA-N |
| XLogP | 0.70 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |