C8H16N2O2 — CID 6950966
(2S,3S)-2-acetamido-3-methylpentanamide (PubChem CID 6950966) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is (2S,3S)-2-acetamido-3-methylpentanamide.
| Compound Name | (2S,3S)-2-acetamido-3-methylpentanamide |
|---|---|
| PubChem CID | 6950966 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | (2S,3S)-2-acetamido-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](NC(C)=O)C(N)=O |
| InChI | InChI=1S/C8H16N2O2/c1-4-5(2)7(8(9)12)10-6(3)11/h5,7H,4H2,1-3H3,(H2,9,12)(H,10,11)/t5-,7-/m0/s1 |
| InChIKey | WFBXRBMLCXMBBM-FSPLSTOPSA-N |
| XLogP | 0.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |