C16H30N4O4 — CID 23276427
2-[[2-(2-acetamidopropanoylamino)-3-methylbutanoyl]amino]-3-methylpentanamide (PubChem CID 23276427) has the molecular formula C16H30N4O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[[2-(2-acetamidopropanoylamino)-3-methylbutanoyl]amino]-3-methylpentanamide.
| Compound Name | 2-[[2-(2-acetamidopropanoylamino)-3-methylbutanoyl]amino]-3-methylpentanamide |
|---|---|
| PubChem CID | 23276427 |
| Molecular Formula | C16H30N4O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 2-[[2-(2-acetamidopropanoylamino)-3-methylbutanoyl]amino]-3-methylpentanamide |
| SMILES | CCC(C)C(NC(=O)C(NC(=O)C(C)NC(C)=O)C(C)C)C(N)=O |
| InChI | InChI=1S/C16H30N4O4/c1-7-9(4)13(14(17)22)20-16(24)12(8(2)3)19-15(23)10(5)18-11(6)21/h8-10,12-13H,7H2,1-6H3,(H2,17,22)(H,18,21)(H,19,23)(H,20,24) |
| InChIKey | SMZRFAJRXYPQLV-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |