C12H22N2O3 — CID 167869588
(2S,3S)-3-methyl-2-[(3-methyl-2-oxopentanoyl)amino]pentanamide (PubChem CID 167869588) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[(3-methyl-2-oxopentanoyl)amino]pentanamide.
| Compound Name | (2S,3S)-3-methyl-2-[(3-methyl-2-oxopentanoyl)amino]pentanamide |
|---|---|
| PubChem CID | 167869588 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | (2S,3S)-3-methyl-2-[(3-methyl-2-oxopentanoyl)amino]pentanamide |
| SMILES | CCC(C)C(=O)C(=O)N[C@H](C(N)=O)[C@@H](C)CC |
| InChI | InChI=1S/C12H22N2O3/c1-5-7(3)9(11(13)16)14-12(17)10(15)8(4)6-2/h7-9H,5-6H2,1-4H3,(H2,13,16)(H,14,17)/t7-,8?,9-/m0/s1 |
| InChIKey | BFCCMGALKCSLTP-SMOXQLQSSA-N |
| XLogP | 0.62 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|