C10H16Cl2N2O2 — CID 78790829
N-(1-amino-3-methyl-1-oxopentan-2-yl)-2,2-dichlorocyclopropane-1-carboxamide (PubChem CID 78790829) has the molecular formula C10H16Cl2N2O2 and a molecular weight of 267.16 g/mol. Its IUPAC name is N-(1-amino-3-methyl-1-oxopentan-2-yl)-2,2-dichlorocyclopropane-1-carboxamide.
| Compound Name | N-(1-amino-3-methyl-1-oxopentan-2-yl)-2,2-dichlorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78790829 |
| Molecular Formula | C10H16Cl2N2O2 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | N-(1-amino-3-methyl-1-oxopentan-2-yl)-2,2-dichlorocyclopropane-1-carboxamide |
| SMILES | CCC(C)C(NC(=O)C1CC1(Cl)Cl)C(N)=O |
| InChI | InChI=1S/C10H16Cl2N2O2/c1-3-5(2)7(8(13)15)14-9(16)6-4-10(6,11)12/h5-7H,3-4H2,1-2H3,(H2,13,15)(H,14,16) |
| InChIKey | AHVUWQKDYLGSKH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|