C8H12Cl2N2O3 — CID 97062033
(1R)-N-[(2S)-1-amino-3-methoxy-1-oxopropan-2-yl]-2,2-dichlorocyclopropane-1-carboxamide (PubChem CID 97062033) has the molecular formula C8H12Cl2N2O3 and a molecular weight of 255.10 g/mol. Its IUPAC name is (1R)-N-[(2S)-1-amino-3-methoxy-1-oxopropan-2-yl]-2,2-dichlorocyclopropane-1-carboxamide.
| Compound Name | (1R)-N-[(2S)-1-amino-3-methoxy-1-oxopropan-2-yl]-2,2-dichlorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 97062033 |
| Molecular Formula | C8H12Cl2N2O3 |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | (1R)-N-[(2S)-1-amino-3-methoxy-1-oxopropan-2-yl]-2,2-dichlorocyclopropane-1-carboxamide |
| SMILES | COC[C@H](NC(=O)[C@H]1CC1(Cl)Cl)C(N)=O |
| InChI | InChI=1S/C8H12Cl2N2O3/c1-15-3-5(6(11)13)12-7(14)4-2-8(4,9)10/h4-5H,2-3H2,1H3,(H2,11,13)(H,12,14)/t4-,5+/m1/s1 |
| InChIKey | XEAXSEDKAQZDGP-UHNVWZDZSA-N |
| XLogP | -0.20 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|