C10H22N2O3 — CID 115929791
3-methoxy-2-[(1-methoxy-3-methylbutan-2-yl)amino]propanamide (PubChem CID 115929791) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-methoxy-2-[(1-methoxy-3-methylbutan-2-yl)amino]propanamide.
| Compound Name | 3-methoxy-2-[(1-methoxy-3-methylbutan-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 115929791 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 3-methoxy-2-[(1-methoxy-3-methylbutan-2-yl)amino]propanamide |
| SMILES | COCC(NC(COC)C(C)C)C(N)=O |
| InChI | InChI=1S/C10H22N2O3/c1-7(2)8(5-14-3)12-9(6-15-4)10(11)13/h7-9,12H,5-6H2,1-4H3,(H2,11,13) |
| InChIKey | GBAJNTAYIQDRFY-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |