C8H17NO2 — CID 167034901
N-[(2S)-1-methoxy-3-methylbutan-2-yl]acetamide (PubChem CID 167034901) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is N-[(2S)-1-methoxy-3-methylbutan-2-yl]acetamide.
| Compound Name | N-[(2S)-1-methoxy-3-methylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 167034901 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | N-[(2S)-1-methoxy-3-methylbutan-2-yl]acetamide |
| SMILES | COC[C@@H](NC(C)=O)C(C)C |
| InChI | InChI=1S/C8H17NO2/c1-6(2)8(5-11-4)9-7(3)10/h6,8H,5H2,1-4H3,(H,9,10)/t8-/m1/s1 |
| InChIKey | FZUQUKJQTQOGMI-MRVPVSSYSA-N |
| XLogP | 0.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |