C7H15NOS — CID 130023779
N-(3-methyl-1-sulfanylbutan-2-yl)acetamide (PubChem CID 130023779) has the molecular formula C7H15NOS and a molecular weight of 161.27 g/mol. Its IUPAC name is N-(3-methyl-1-sulfanylbutan-2-yl)acetamide.
| Compound Name | N-(3-methyl-1-sulfanylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 130023779 |
| Molecular Formula | C7H15NOS |
| Molecular Weight | 161.27 g/mol |
| Exact Mass | 161.09 |
| IUPAC Name | N-(3-methyl-1-sulfanylbutan-2-yl)acetamide |
| SMILES | CC(=O)NC(CS)C(C)C |
| InChI | InChI=1S/C7H15NOS/c1-5(2)7(4-10)8-6(3)9/h5,7,10H,4H2,1-3H3,(H,8,9) |
| InChIKey | HIWICOVJFXOKJD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|