C9H19NOS2 — CID 165173028
2-methyl-N-[(2R)-3-methyl-1-sulfanylbutan-2-yl]-2-sulfanylpropanamide (PubChem CID 165173028) has the molecular formula C9H19NOS2 and a molecular weight of 221.39 g/mol. Its IUPAC name is 2-methyl-N-[(2R)-3-methyl-1-sulfanylbutan-2-yl]-2-sulfanylpropanamide.
| Compound Name | 2-methyl-N-[(2R)-3-methyl-1-sulfanylbutan-2-yl]-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 165173028 |
| Molecular Formula | C9H19NOS2 |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-methyl-N-[(2R)-3-methyl-1-sulfanylbutan-2-yl]-2-sulfanylpropanamide |
| SMILES | CC(C)[C@H](CS)NC(=O)C(C)(C)S |
| InChI | InChI=1S/C9H19NOS2/c1-6(2)7(5-12)10-8(11)9(3,4)13/h6-7,12-13H,5H2,1-4H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | JXMBOJUQDSUZPX-ZETCQYMHSA-N |
| XLogP | 1.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|