C9H13Cl2NO4 — CID 115596423
2-[(2,2-dichlorocyclopropanecarbonyl)-(2-methoxyethyl)amino]acetic acid (PubChem CID 115596423) has the molecular formula C9H13Cl2NO4 and a molecular weight of 270.11 g/mol. Its IUPAC name is 2-[(2,2-dichlorocyclopropanecarbonyl)-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[(2,2-dichlorocyclopropanecarbonyl)-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 115596423 |
| Molecular Formula | C9H13Cl2NO4 |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 2-[(2,2-dichlorocyclopropanecarbonyl)-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)C1CC1(Cl)Cl |
| InChI | InChI=1S/C9H13Cl2NO4/c1-16-3-2-12(5-7(13)14)8(15)6-4-9(6,10)11/h6H,2-5H2,1H3,(H,13,14) |
| InChIKey | AFWINAJHTRATQQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|